C9H8Cl2 — CID 70502505
1,4-dichloro-2-prop-1-enylbenzene (PubChem CID 70502505) has the molecular formula C9H8Cl2 and a molecular weight of 187.07 g/mol. Its IUPAC name is 1,4-dichloro-2-prop-1-enylbenzene.
| Compound Name | 1,4-dichloro-2-prop-1-enylbenzene |
|---|---|
| PubChem CID | 70502505 |
| Molecular Formula | C9H8Cl2 |
| Molecular Weight | 187.07 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 1,4-dichloro-2-prop-1-enylbenzene |
| SMILES | CC=Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2/c1-2-3-7-6-8(10)4-5-9(7)11/h2-6H,1H3 |
| InChIKey | BDIVPQHPHFRKQM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.07 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |