About 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid
4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70502512) has the molecular formula C25H34O2
and a molecular weight of 366.55 g/mol. Its IUPAC name is 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| PubChem CID | 70502512 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCc1ccccc1C1(C2CCC(CCC)CC2)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C25H34O2/c1-3-7-19-11-13-22(14-12-19)25(17-15-21(16-18-25)24(26)27)23-10-6-5-9-20(23)8-4-2/h5-6,9-10,15-19,21-22H,3-4,7-8,11-14H2,1-2H3,(H,26,27) |
| InChIKey | GZODSVJEODSXAM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The IUPAC name of 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (CID 70502512) is 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The canonical SMILES for 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid is CCCc1ccccc1C1(C2CCC(CCC)CC2)C=CC(C(=O)O)C=C1.
What is the InChIKey of 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The InChIKey is GZODSVJEODSXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O2/c1-3-7-19-11-13-22(14-12-19)25(17-15-21(16-18-25)24(26)27)23-10-6-5-9-20(23)8-4-2/h5-6,9-10,15-19,21-22H,3-4,7-8,11-14H2,1-2H3,(H,26,27).
What are the key properties of 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid has a molecular weight of 366.55 g/mol, XLogP of 6.31, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propylcyclohexyl)-4-(2-propylphenyl)cyclohexa-2,5-diene-1-carboxylic acid is sourced from PubChem (CID 70502512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).