C18H19Cl2NO3 — CID 70502903
ethyl 2-[benzoyl-(1,5-dichlorocyclohexa-2,4-dien-1-yl)amino]propanoate (PubChem CID 70502903) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is ethyl 2-[benzoyl-(1,5-dichlorocyclohexa-2,4-dien-1-yl)amino]propanoate.
| Compound Name | ethyl 2-[benzoyl-(1,5-dichlorocyclohexa-2,4-dien-1-yl)amino]propanoate |
|---|---|
| PubChem CID | 70502903 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | ethyl 2-[benzoyl-(1,5-dichlorocyclohexa-2,4-dien-1-yl)amino]propanoate |
| SMILES | CCOC(=O)C(C)N(C(=O)c1ccccc1)C1(Cl)C=CC=C(Cl)C1 |
| InChI | InChI=1S/C18H19Cl2NO3/c1-3-24-17(23)13(2)21(16(22)14-8-5-4-6-9-14)18(20)11-7-10-15(19)12-18/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | HGDWIDBIFXUMAL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|