About 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate
3-methyl-1,3-thiazolidin-3-ium-3-carboxylate (PubChem CID 70502927) has the molecular formula C5H9NO2S
and a molecular weight of 147.20 g/mol. Its IUPAC name is 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate.
Molecular Properties
| Compound Name | 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate |
| PubChem CID | 70502927 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate |
| SMILES | C[N+]1(C(=O)[O-])CCSC1 |
| InChI | InChI=1S/C5H9NO2S/c1-6(5(7)8)2-3-9-4-6/h2-4H2,1H3 |
| InChIKey | PTTQXQCGTICDLT-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate?
The IUPAC name of 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate (CID 70502927) is 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate.
What is the SMILES notation for 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate?
The canonical SMILES for 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate is C[N+]1(C(=O)[O-])CCSC1.
What is the InChIKey of 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate?
The InChIKey is PTTQXQCGTICDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2S/c1-6(5(7)8)2-3-9-4-6/h2-4H2,1H3.
What are the key properties of 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate?
3-methyl-1,3-thiazolidin-3-ium-3-carboxylate has a molecular weight of 147.20 g/mol, XLogP of -0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-thiazolidin-3-ium-3-carboxylate is sourced from PubChem (CID 70502927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).