C21H24O5 — CID 70503283
prop-2-enyl 3-hydroxy-4-(2-phenylmethoxyphenoxy)pentanoate (PubChem CID 70503283) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is prop-2-enyl 3-hydroxy-4-(2-phenylmethoxyphenoxy)pentanoate.
| Compound Name | prop-2-enyl 3-hydroxy-4-(2-phenylmethoxyphenoxy)pentanoate |
|---|---|
| PubChem CID | 70503283 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | prop-2-enyl 3-hydroxy-4-(2-phenylmethoxyphenoxy)pentanoate |
| SMILES | C=CCOC(=O)CC(O)C(C)Oc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O5/c1-3-13-24-21(23)14-18(22)16(2)26-20-12-8-7-11-19(20)25-15-17-9-5-4-6-10-17/h3-12,16,18,22H,1,13-15H2,2H3 |
| InChIKey | XQUQHKHEQARVSC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|