C23H22F3N3O4S — CID 7050337
N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methoxy-4-methylsulfanylbenzamide (PubChem CID 7050337) has the molecular formula C23H22F3N3O4S and a molecular weight of 493.51 g/mol. Its IUPAC name is N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methoxy-4-methylsulfanylbenzamide.
| Compound Name | N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methoxy-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 7050337 |
| Molecular Formula | C23H22F3N3O4S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | N-[(7S,8aS)-1,3-dioxo-2-[3-(trifluoromethyl)phenyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methoxy-4-methylsulfanylbenzamide |
| SMILES | COc1cc(SC)ccc1C(=O)N[C@H]1CCN2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H22F3N3O4S/c1-33-19-12-16(34-2)6-7-17(19)20(30)27-14-8-9-28-18(11-14)21(31)29(22(28)32)15-5-3-4-13(10-15)23(24,25)26/h3-7,10,12,14,18H,8-9,11H2,1-2H3,(H,27,30)/t14-,18-/m0/s1 |
| InChIKey | HJHDQNYMMOLYDR-KSSFIOAISA-N |
| XLogP | 4.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|