About benzene-1,4-diol;propan-2-one
benzene-1,4-diol;propan-2-one (PubChem CID 70503391) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is benzene-1,4-diol;propan-2-one.
Molecular Properties
| Compound Name | benzene-1,4-diol;propan-2-one |
| PubChem CID | 70503391 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | benzene-1,4-diol;propan-2-one |
| SMILES | CC(C)=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C3H6O/c7-5-1-2-6(8)4-3-5;1-3(2)4/h1-4,7-8H;1-2H3 |
| InChIKey | KJCDXDTWIHMZIC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;propan-2-one?
The IUPAC name of benzene-1,4-diol;propan-2-one (CID 70503391) is benzene-1,4-diol;propan-2-one.
What is the SMILES notation for benzene-1,4-diol;propan-2-one?
The canonical SMILES for benzene-1,4-diol;propan-2-one is CC(C)=O.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;propan-2-one?
The InChIKey is KJCDXDTWIHMZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C3H6O/c7-5-1-2-6(8)4-3-5;1-3(2)4/h1-4,7-8H;1-2H3.
What are the key properties of benzene-1,4-diol;propan-2-one?
benzene-1,4-diol;propan-2-one has a molecular weight of 168.19 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;propan-2-one is sourced from PubChem (CID 70503391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).