C16H28O — CID 70503450
(1Z,5Z)-10-methoxy-1,5,10-trimethylcyclododeca-1,5-diene (PubChem CID 70503450) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (1Z,5Z)-10-methoxy-1,5,10-trimethylcyclododeca-1,5-diene.
| Compound Name | (1Z,5Z)-10-methoxy-1,5,10-trimethylcyclododeca-1,5-diene |
|---|---|
| PubChem CID | 70503450 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (1Z,5Z)-10-methoxy-1,5,10-trimethylcyclododeca-1,5-diene |
| SMILES | COC1(C)CCC/C=C(/C)CC/C=C(/C)CC1 |
| InChI | InChI=1S/C16H28O/c1-14-8-5-6-12-16(3,17-4)13-11-15(2)10-7-9-14/h8,10H,5-7,9,11-13H2,1-4H3/b14-8-,15-10- |
| InChIKey | FZIGDKXILZIFTK-CKXDQZPMSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|