About pyrrolo[2,3-i][1,2,3]benzotriazepine
pyrrolo[2,3-i][1,2,3]benzotriazepine (PubChem CID 70504160) has the molecular formula C10H6N4
and a molecular weight of 182.19 g/mol. Its IUPAC name is pyrrolo[2,3-i][1,2,3]benzotriazepine.
Molecular Properties
| Compound Name | pyrrolo[2,3-i][1,2,3]benzotriazepine |
| PubChem CID | 70504160 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | pyrrolo[2,3-i][1,2,3]benzotriazepine |
| SMILES | c1cc2ccc3nccc3c2nnn1 |
| InChI | InChI=1S/C10H6N4/c1-2-9-8(4-5-11-9)10-7(1)3-6-12-14-13-10/h1-6H |
| InChIKey | AEDPOXGBXKZDPT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolo[2,3-i][1,2,3]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-i][1,2,3]benzotriazepine?
The IUPAC name of pyrrolo[2,3-i][1,2,3]benzotriazepine (CID 70504160) is pyrrolo[2,3-i][1,2,3]benzotriazepine.
What is the SMILES notation for pyrrolo[2,3-i][1,2,3]benzotriazepine?
The canonical SMILES for pyrrolo[2,3-i][1,2,3]benzotriazepine is c1cc2ccc3nccc3c2nnn1.
What is the InChIKey of pyrrolo[2,3-i][1,2,3]benzotriazepine?
The InChIKey is AEDPOXGBXKZDPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4/c1-2-9-8(4-5-11-9)10-7(1)3-6-12-14-13-10/h1-6H.
What are the key properties of pyrrolo[2,3-i][1,2,3]benzotriazepine?
pyrrolo[2,3-i][1,2,3]benzotriazepine has a molecular weight of 182.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-i][1,2,3]benzotriazepine is sourced from PubChem (CID 70504160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).