About benzenesulfinamide;1-(4-propylphenyl)piperazine
benzenesulfinamide;1-(4-propylphenyl)piperazine (PubChem CID 70504489) has the molecular formula C19H27N3OS
and a molecular weight of 345.51 g/mol. Its IUPAC name is benzenesulfinamide;1-(4-propylphenyl)piperazine.
Molecular Properties
| Compound Name | benzenesulfinamide;1-(4-propylphenyl)piperazine |
| PubChem CID | 70504489 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | benzenesulfinamide;1-(4-propylphenyl)piperazine |
| SMILES | CCCc1ccc(N2CCNCC2)cc1.NS(=O)c1ccccc1 |
| InChI | InChI=1S/C13H20N2.C6H7NOS/c1-2-3-12-4-6-13(7-5-12)15-10-8-14-9-11-15;7-9(8)6-4-2-1-3-5-6/h4-7,14H,2-3,8-11H2,1H3;1-5H,7H2 |
| InChIKey | RUDCGPJSZWNKPC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfinamide;1-(4-propylphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinamide;1-(4-propylphenyl)piperazine?
The IUPAC name of benzenesulfinamide;1-(4-propylphenyl)piperazine (CID 70504489) is benzenesulfinamide;1-(4-propylphenyl)piperazine.
What is the SMILES notation for benzenesulfinamide;1-(4-propylphenyl)piperazine?
The canonical SMILES for benzenesulfinamide;1-(4-propylphenyl)piperazine is CCCc1ccc(N2CCNCC2)cc1.NS(=O)c1ccccc1.
What is the InChIKey of benzenesulfinamide;1-(4-propylphenyl)piperazine?
The InChIKey is RUDCGPJSZWNKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.C6H7NOS/c1-2-3-12-4-6-13(7-5-12)15-10-8-14-9-11-15;7-9(8)6-4-2-1-3-5-6/h4-7,14H,2-3,8-11H2,1H3;1-5H,7H2.
What are the key properties of benzenesulfinamide;1-(4-propylphenyl)piperazine?
benzenesulfinamide;1-(4-propylphenyl)piperazine has a molecular weight of 345.51 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinamide;1-(4-propylphenyl)piperazine is sourced from PubChem (CID 70504489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).