C10H16N4O8 — CID 70504522
azanium (2S,3S,4S,5R,6S)-6-[(5-carbamoyl-1H-imidazol-4-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 70504522) has the molecular formula C10H16N4O8 and a molecular weight of 320.26 g/mol. Its IUPAC name is azanium (2S,3S,4S,5R,6S)-6-[(5-carbamoyl-1H-imidazol-4-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | azanium (2S,3S,4S,5R,6S)-6-[(5-carbamoyl-1H-imidazol-4-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 70504522 |
| Molecular Formula | C10H16N4O8 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | azanium (2S,3S,4S,5R,6S)-6-[(5-carbamoyl-1H-imidazol-4-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | NC(=O)c1[nH]cnc1O[C@@H]1O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.[NH4+] |
| InChI | InChI=1S/C10H13N3O8.H3N/c11-7(17)2-8(13-1-12-2)21-10-5(16)3(14)4(15)6(20-10)9(18)19;/h1,3-6,10,14-16H,(H2,11,17)(H,12,13)(H,18,19);1H3/t3-,4-,5+,6-,10-;/m0./s1 |
| InChIKey | LLJOKBXUNNVPRV-GLHOPGBLSA-N |
| XLogP | -4.18 |
| TPSA | 227.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |