About bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate
bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate (PubChem CID 70504530) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate.
Molecular Properties
| Compound Name | bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate |
| PubChem CID | 70504530 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate |
| SMILES | C1=CCC=C1.C1=CCC=C1.COC(=O)C=CC(=O)OC |
| InChI | InChI=1S/C6H8O4.2C5H6/c1-9-5(7)3-4-6(8)10-2;2*1-2-4-5-3-1/h3-4H,1-2H3;2*1-4H,5H2 |
| InChIKey | IXEWZGITNSDSLN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate?
The IUPAC name of bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate (CID 70504530) is bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate.
What is the SMILES notation for bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate?
The canonical SMILES for bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate is C1=CCC=C1.C1=CCC=C1.COC(=O)C=CC(=O)OC.
What is the InChIKey of bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate?
The InChIKey is IXEWZGITNSDSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4.2C5H6/c1-9-5(7)3-4-6(8)10-2;2*1-2-4-5-3-1/h3-4H,1-2H3;2*1-4H,5H2.
What are the key properties of bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate?
bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate has a molecular weight of 276.33 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-1,3-diene);dimethyl but-2-enedioate is sourced from PubChem (CID 70504530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).