About CID 70505229
CID 70505229 (PubChem CID 70505229) has the molecular formula C6H4Na3O7
and a molecular weight of 257.06 g/mol.
Molecular Properties
| Compound Name | CID 70505229 |
| PubChem CID | 70505229 |
| Molecular Formula | C6H4Na3O7 |
| Molecular Weight | 257.06 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | — |
| SMILES | O=C(O)C1=C(C(=O)O)C(C(=O)O)O1.[Na].[Na].[Na] |
| InChI | InChI=1S/C6H4O7.3Na/c7-4(8)1-2(5(9)10)13-3(1)6(11)12;;;/h2H,(H,7,8)(H,9,10)(H,11,12);;; |
| InChIKey | RFMSNSJVNUFJMI-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.06 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 70505229 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70505229?
The IUPAC name of CID 70505229 (CID 70505229) is not available.
What is the SMILES notation for CID 70505229?
The canonical SMILES for CID 70505229 is O=C(O)C1=C(C(=O)O)C(C(=O)O)O1.[Na].[Na].[Na].
What is the InChIKey of CID 70505229?
The InChIKey is RFMSNSJVNUFJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O7.3Na/c7-4(8)1-2(5(9)10)13-3(1)6(11)12;;;/h2H,(H,7,8)(H,9,10)(H,11,12);;;.
What are the key properties of CID 70505229?
CID 70505229 has a molecular weight of 257.06 g/mol, XLogP of -2.25, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70505229 is sourced from PubChem (CID 70505229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).