About hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate
hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate (PubChem CID 70505240) has the molecular formula C23H33Cl2NO3
and a molecular weight of 442.43 g/mol. Its IUPAC name is hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate.
Molecular Properties
| Compound Name | hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate |
| PubChem CID | 70505240 |
| Molecular Formula | C23H33Cl2NO3 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate |
| SMILES | C=C(C/C(=N/c1cc(Cl)cc(Cl)c1)OCCCCCC)C(=O)OCCCCCC |
| InChI | InChI=1S/C23H33Cl2NO3/c1-4-6-8-10-12-28-22(26-21-16-19(24)15-20(25)17-21)14-18(3)23(27)29-13-11-9-7-5-2/h15-17H,3-14H2,1-2H3/b26-22- |
| InChIKey | PCINLALXRQTAAS-ROMGYVFFSA-N |
| XLogP | 7.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate?
The IUPAC name of hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate (CID 70505240) is hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate.
What is the SMILES notation for hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate?
The canonical SMILES for hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate is C=C(C/C(=N/c1cc(Cl)cc(Cl)c1)OCCCCCC)C(=O)OCCCCCC.
What is the InChIKey of hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate?
The InChIKey is PCINLALXRQTAAS-ROMGYVFFSA-N. The full InChI is InChI=1S/C23H33Cl2NO3/c1-4-6-8-10-12-28-22(26-21-16-19(24)15-20(25)17-21)14-18(3)23(27)29-13-11-9-7-5-2/h15-17H,3-14H2,1-2H3/b26-22-.
What are the key properties of hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate?
hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate has a molecular weight of 442.43 g/mol, XLogP of 7.69, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 4-(3,5-dichlorophenyl)imino-4-hexoxy-2-methylidenebutanoate is sourced from PubChem (CID 70505240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).