C24H25NO4Si — CID 70505253
(1R,2S)-2-ethyl-5-hydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile (PubChem CID 70505253) has the molecular formula C24H25NO4Si and a molecular weight of 419.55 g/mol. Its IUPAC name is (1R,2S)-2-ethyl-5-hydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile.
| Compound Name | (1R,2S)-2-ethyl-5-hydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
|---|---|
| PubChem CID | 70505253 |
| Molecular Formula | C24H25NO4Si |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (1R,2S)-2-ethyl-5-hydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
| SMILES | CC[C@H]1CCc2c(cc3c(c2O)C(=O)c2ccccc2C3=O)[C@]1(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C24H25NO4Si/c1-5-14-10-11-17-19(24(14,13-25)29-30(2,3)4)12-18-20(23(17)28)22(27)16-9-7-6-8-15(16)21(18)26/h6-9,12,14,28H,5,10-11H2,1-4H3/t14-,24+/m0/s1 |
| InChIKey | CBMNOUHZNJROFT-LFPIHBKWSA-N |
| XLogP | 4.71 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|