About 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate
1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate (PubChem CID 70505879) has the molecular formula C15H19Cl2N3O3
and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate.
Molecular Properties
| Compound Name | 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate |
| PubChem CID | 70505879 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate |
| SMILES | C=C(C/C(=N/c1cc(Cl)cc(Cl)c1)OC(C)N)C(=O)OC(C)N |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-8(15(21)23-10(3)19)4-14(22-9(2)18)20-13-6-11(16)5-12(17)7-13/h5-7,9-10H,1,4,18-19H2,2-3H3/b20-14- |
| InChIKey | ZVOHEXRZJKHUJB-ZHZULCJRSA-N |
| XLogP | 3.14 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate?
The IUPAC name of 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate (CID 70505879) is 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate.
What is the SMILES notation for 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate?
The canonical SMILES for 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate is C=C(C/C(=N/c1cc(Cl)cc(Cl)c1)OC(C)N)C(=O)OC(C)N.
What is the InChIKey of 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate?
The InChIKey is ZVOHEXRZJKHUJB-ZHZULCJRSA-N. The full InChI is InChI=1S/C15H19Cl2N3O3/c1-8(15(21)23-10(3)19)4-14(22-9(2)18)20-13-6-11(16)5-12(17)7-13/h5-7,9-10H,1,4,18-19H2,2-3H3/b20-14-.
What are the key properties of 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate?
1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate has a molecular weight of 360.24 g/mol, XLogP of 3.14, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 4-(1-aminoethoxy)-4-(3,5-dichlorophenyl)imino-2-methylidenebutanoate is sourced from PubChem (CID 70505879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).