C22H29N3O4S — CID 70506182
diethyl 2-[[3-(8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-7-yl)propylamino]methylidene]propanedioate (PubChem CID 70506182) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is diethyl 2-[[3-(8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-7-yl)propylamino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[3-(8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-7-yl)propylamino]methylidene]propanedioate |
|---|---|
| PubChem CID | 70506182 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | diethyl 2-[[3-(8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-7-yl)propylamino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNCCCc1cc2c(cc1C)SC1=NCCCN12)C(=O)OCC |
| InChI | InChI=1S/C22H29N3O4S/c1-4-28-20(26)17(21(27)29-5-2)14-23-9-6-8-16-13-18-19(12-15(16)3)30-22-24-10-7-11-25(18)22/h12-14,23H,4-11H2,1-3H3 |
| InChIKey | YPEFEFVXAXHHDN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|