C29H43ClN2 — CID 70506236
1-N-but-2-enyl-1-(4-chlorophenyl)-4-N,3-dimethyl-1-N-propylcyclohexane-1,4-diamine;ethylbenzene (PubChem CID 70506236) has the molecular formula C29H43ClN2 and a molecular weight of 455.13 g/mol. Its IUPAC name is 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N,3-dimethyl-1-N-propylcyclohexane-1,4-diamine;ethylbenzene.
| Compound Name | 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N,3-dimethyl-1-N-propylcyclohexane-1,4-diamine;ethylbenzene |
|---|---|
| PubChem CID | 70506236 |
| Molecular Formula | C29H43ClN2 |
| Molecular Weight | 455.13 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N,3-dimethyl-1-N-propylcyclohexane-1,4-diamine;ethylbenzene |
| SMILES | CC=CCN(CCC)C1(c2ccc(Cl)cc2)CCC(NC)C(C)C1.CCc1ccccc1 |
| InChI | InChI=1S/C21H33ClN2.C8H10/c1-5-7-15-24(14-6-2)21(18-8-10-19(22)11-9-18)13-12-20(23-4)17(3)16-21;1-2-8-6-4-3-5-7-8/h5,7-11,17,20,23H,6,12-16H2,1-4H3;3-7H,2H2,1H3 |
| InChIKey | UFLLLHIQAGASFU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.13 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|