C26H42O5 — CID 70506685
ethyl 1-(1-ethoxycarbonyl-2,5,6,6-tetramethylcyclohex-2-en-1-yl)oxy-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate (PubChem CID 70506685) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is ethyl 1-(1-ethoxycarbonyl-2,5,6,6-tetramethylcyclohex-2-en-1-yl)oxy-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 1-(1-ethoxycarbonyl-2,5,6,6-tetramethylcyclohex-2-en-1-yl)oxy-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 70506685 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | ethyl 1-(1-ethoxycarbonyl-2,5,6,6-tetramethylcyclohex-2-en-1-yl)oxy-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(OC2(C(=O)OCC)C(C)=CCC(C)C2(C)C)C(C)=CCC(C)C1(C)C |
| InChI | InChI=1S/C26H42O5/c1-11-29-21(27)25(19(5)15-13-17(3)23(25,7)8)31-26(22(28)30-12-2)20(6)16-14-18(4)24(26,9)10/h15-18H,11-14H2,1-10H3 |
| InChIKey | GZERTHNFIIGYNS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|