C18H19NO4S — CID 70506744
3-[4-(2-methoxyethoxy)-3,5-dimethylphenyl]-1,2-benzothiazole 1,1-dioxide (PubChem CID 70506744) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-[4-(2-methoxyethoxy)-3,5-dimethylphenyl]-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-[4-(2-methoxyethoxy)-3,5-dimethylphenyl]-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 70506744 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[4-(2-methoxyethoxy)-3,5-dimethylphenyl]-1,2-benzothiazole 1,1-dioxide |
| SMILES | COCCOc1c(C)cc(C2=NS(=O)(=O)c3ccccc32)cc1C |
| InChI | InChI=1S/C18H19NO4S/c1-12-10-14(11-13(2)18(12)23-9-8-22-3)17-15-6-4-5-7-16(15)24(20,21)19-17/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | PGLSHDPKAYTZPB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|