About 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine
5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine (PubChem CID 70506921) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine.
Molecular Properties
| Compound Name | 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine |
| PubChem CID | 70506921 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine |
| SMILES | C=NCC.CC1(C)C=CC=CC1 |
| InChI | InChI=1S/C8H12.C3H7N/c1-8(2)6-4-3-5-7-8;1-3-4-2/h3-6H,7H2,1-2H3;2-3H2,1H3 |
| InChIKey | GKDYKHSOUDPXJX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine?
The IUPAC name of 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine (CID 70506921) is 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine.
What is the SMILES notation for 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine?
The canonical SMILES for 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine is C=NCC.CC1(C)C=CC=CC1.
What is the InChIKey of 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine?
The InChIKey is GKDYKHSOUDPXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.C3H7N/c1-8(2)6-4-3-5-7-8;1-3-4-2/h3-6H,7H2,1-2H3;2-3H2,1H3.
What are the key properties of 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine?
5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine has a molecular weight of 165.28 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylcyclohexa-1,3-diene;N-ethylmethanimine is sourced from PubChem (CID 70506921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).