C26H50O3Si2 — CID 70506922
4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methylidenecyclopentan-1-one (PubChem CID 70506922) has the molecular formula C26H50O3Si2 and a molecular weight of 466.86 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methylidenecyclopentan-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 70506922 |
| Molecular Formula | C26H50O3Si2 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)CC(O[Si](C)(C)C(C)(C)C)C1/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O3Si2/c1-13-14-15-16-21(28-30(9,10)25(3,4)5)17-18-22-20(2)23(27)19-24(22)29-31(11,12)26(6,7)8/h17-18,21-22,24H,2,13-16,19H2,1,3-12H3/b18-17+/t21-,22?,24?/m0/s1 |
| InChIKey | IGKHFOHAYMJIQY-YUTPOZBOSA-N |
| XLogP | 8.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|