C18H29N — CID 70507087
(11E,15E)-9,9-dimethyl-7-azaspiro[5.11]heptadeca-7,11,15-triene (PubChem CID 70507087) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (11E,15E)-9,9-dimethyl-7-azaspiro[5.11]heptadeca-7,11,15-triene.
| Compound Name | (11E,15E)-9,9-dimethyl-7-azaspiro[5.11]heptadeca-7,11,15-triene |
|---|---|
| PubChem CID | 70507087 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (11E,15E)-9,9-dimethyl-7-azaspiro[5.11]heptadeca-7,11,15-triene |
| SMILES | CC1(C)/C=N/C2(C/C=C/CC/C=C/C1)CCCCC2 |
| InChI | InChI=1S/C18H29N/c1-17(2)12-8-5-3-4-6-9-13-18(19-16-17)14-10-7-11-15-18/h5-6,8-9,16H,3-4,7,10-15H2,1-2H3/b8-5+,9-6+,19-16+ |
| InChIKey | BGRQKVHFDXWRQH-ISZURTPPSA-N |
| XLogP | 5.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|