About 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid
2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid (PubChem CID 70507174) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid.
Molecular Properties
| Compound Name | 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid |
| PubChem CID | 70507174 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid |
| SMILES | CCOC1(C=C(C(=O)O)C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C12H14O5/c1-2-17-12(6-4-3-5-7-12)8-9(10(13)14)11(15)16/h3-6,8H,2,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FAUUVGBFCZGNKX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid?
The IUPAC name of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid (CID 70507174) is 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid.
What is the SMILES notation for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid?
The canonical SMILES for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid is CCOC1(C=C(C(=O)O)C(=O)O)C=CC=CC1.
What is the InChIKey of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid?
The InChIKey is FAUUVGBFCZGNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-2-17-12(6-4-3-5-7-12)8-9(10(13)14)11(15)16/h3-6,8H,2,7H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid?
2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid has a molecular weight of 238.24 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)methylidene]propanedioic acid is sourced from PubChem (CID 70507174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).