C29H50N2O4 — CID 70507235
tert-butyl N-[[(3R,5S,10S,13S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-propanoylamino]carbamate (PubChem CID 70507235) has the molecular formula C29H50N2O4 and a molecular weight of 490.73 g/mol. Its IUPAC name is tert-butyl N-[[(3R,5S,10S,13S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-propanoylamino]carbamate.
| Compound Name | tert-butyl N-[[(3R,5S,10S,13S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-propanoylamino]carbamate |
|---|---|
| PubChem CID | 70507235 |
| Molecular Formula | C29H50N2O4 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | tert-butyl N-[[(3R,5S,10S,13S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-propanoylamino]carbamate |
| SMILES | CCC(=O)N(NC(=O)OC(C)(C)C)[C@@H]1CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4[C@H](C)O)C3CC[C@H]2C1 |
| InChI | InChI=1S/C29H50N2O4/c1-8-25(33)31(30-26(34)35-27(3,4)5)20-13-15-28(6)19(17-20)9-10-21-23-12-11-22(18(2)32)29(23,7)16-14-24(21)28/h18-24,32H,8-17H2,1-7H3,(H,30,34)/t18-,19-,20+,21?,22+,23?,24?,28-,29+/m0/s1 |
| InChIKey | IZAVWYZCYGCUHI-DMTNJURJSA-N |
| XLogP | 6.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|