C30H39NO5 — CID 70507548
ethyl (2S)-1-[(4R)-4-ethoxycarbonyl-10-phenyldecanoyl]-2,3-dihydroindole-2-carboxylate (PubChem CID 70507548) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is ethyl (2S)-1-[(4R)-4-ethoxycarbonyl-10-phenyldecanoyl]-2,3-dihydroindole-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(4R)-4-ethoxycarbonyl-10-phenyldecanoyl]-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 70507548 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | ethyl (2S)-1-[(4R)-4-ethoxycarbonyl-10-phenyldecanoyl]-2,3-dihydroindole-2-carboxylate |
| SMILES | CCOC(=O)[C@H](CCCCCCc1ccccc1)CCC(=O)N1c2ccccc2C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C30H39NO5/c1-3-35-29(33)24(17-11-6-5-8-14-23-15-9-7-10-16-23)20-21-28(32)31-26-19-13-12-18-25(26)22-27(31)30(34)36-4-2/h7,9-10,12-13,15-16,18-19,24,27H,3-6,8,11,14,17,20-22H2,1-2H3/t24-,27+/m1/s1 |
| InChIKey | YOZFVGROEDTAPX-SQHAQQRYSA-N |
| XLogP | 5.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|