C14H20N2O4 — CID 70507560
[1-[4-(2-aminoethyl)phenyl]-1-oxopropan-2-yl] acetate;formamide (PubChem CID 70507560) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [1-[4-(2-aminoethyl)phenyl]-1-oxopropan-2-yl] acetate;formamide.
| Compound Name | [1-[4-(2-aminoethyl)phenyl]-1-oxopropan-2-yl] acetate;formamide |
|---|---|
| PubChem CID | 70507560 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [1-[4-(2-aminoethyl)phenyl]-1-oxopropan-2-yl] acetate;formamide |
| SMILES | CC(=O)OC(C)C(=O)c1ccc(CCN)cc1.NC=O |
| InChI | InChI=1S/C13H17NO3.CH3NO/c1-9(17-10(2)15)13(16)12-5-3-11(4-6-12)7-8-14;2-1-3/h3-6,9H,7-8,14H2,1-2H3;1H,(H2,2,3) |
| InChIKey | YNLQQDVNWIWWNZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|