C14H13O6P — CID 70507728
[2-[3-(5-methylfuran-2-yl)prop-2-enoyl]phenyl] dihydrogen phosphate (PubChem CID 70507728) has the molecular formula C14H13O6P and a molecular weight of 308.23 g/mol. Its IUPAC name is [2-[3-(5-methylfuran-2-yl)prop-2-enoyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-[3-(5-methylfuran-2-yl)prop-2-enoyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70507728 |
| Molecular Formula | C14H13O6P |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | [2-[3-(5-methylfuran-2-yl)prop-2-enoyl]phenyl] dihydrogen phosphate |
| SMILES | Cc1ccc(C=CC(=O)c2ccccc2OP(=O)(O)O)o1 |
| InChI | InChI=1S/C14H13O6P/c1-10-6-7-11(19-10)8-9-13(15)12-4-2-3-5-14(12)20-21(16,17)18/h2-9H,1H3,(H2,16,17,18) |
| InChIKey | XQDLHKZOVIGWRO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|