About 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile
5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile (PubChem CID 70507783) has the molecular formula C20H24FN3O
and a molecular weight of 341.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile |
| PubChem CID | 70507783 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile |
| SMILES | CCCC(C#N)(CCC)C(=O)C(Cc1ccc(F)cc1)n1ccnc1 |
| InChI | InChI=1S/C20H24FN3O/c1-3-9-20(14-22,10-4-2)19(25)18(24-12-11-23-15-24)13-16-5-7-17(21)8-6-16/h5-8,11-12,15,18H,3-4,9-10,13H2,1-2H3 |
| InChIKey | MMGVQOQBJYGZHR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile?
The IUPAC name of 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile (CID 70507783) is 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile.
What is the SMILES notation for 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile?
The canonical SMILES for 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile is CCCC(C#N)(CCC)C(=O)C(Cc1ccc(F)cc1)n1ccnc1.
What is the InChIKey of 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile?
The InChIKey is MMGVQOQBJYGZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24FN3O/c1-3-9-20(14-22,10-4-2)19(25)18(24-12-11-23-15-24)13-16-5-7-17(21)8-6-16/h5-8,11-12,15,18H,3-4,9-10,13H2,1-2H3.
What are the key properties of 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile?
5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile has a molecular weight of 341.43 g/mol, XLogP of 4.49, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-4-imidazol-1-yl-3-oxo-2,2-dipropylpentanenitrile is sourced from PubChem (CID 70507783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).