C12H15F3N4O3S — CID 70508029
2-[2-[[(Z)-2-nitro-1-(2,2,2-trifluoroethylamino)ethenyl]amino]ethylsulfanylmethyl]pyridin-3-ol (PubChem CID 70508029) has the molecular formula C12H15F3N4O3S and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[2-[[(Z)-2-nitro-1-(2,2,2-trifluoroethylamino)ethenyl]amino]ethylsulfanylmethyl]pyridin-3-ol.
| Compound Name | 2-[2-[[(Z)-2-nitro-1-(2,2,2-trifluoroethylamino)ethenyl]amino]ethylsulfanylmethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 70508029 |
| Molecular Formula | C12H15F3N4O3S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[2-[[(Z)-2-nitro-1-(2,2,2-trifluoroethylamino)ethenyl]amino]ethylsulfanylmethyl]pyridin-3-ol |
| SMILES | O=[N+]([O-])/C=C(\NCCSCc1ncccc1O)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O3S/c13-12(14,15)8-18-11(6-19(21)22)17-4-5-23-7-9-10(20)2-1-3-16-9/h1-3,6,17-18,20H,4-5,7-8H2/b11-6+ |
| InChIKey | JVEBALYLIUCBER-IZZDOVSWSA-N |
| XLogP | 1.84 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|