C20H23N5O — CID 70508225
bicyclo[3.1.0]hex-1(5)-ene;(3-hydrazinyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone (PubChem CID 70508225) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is bicyclo[3.1.0]hex-1(5)-ene;(3-hydrazinyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone.
| Compound Name | bicyclo[3.1.0]hex-1(5)-ene;(3-hydrazinyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 70508225 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | bicyclo[3.1.0]hex-1(5)-ene;(3-hydrazinyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-phenylmethanone |
| SMILES | C1CC2=C(C1)C2.NNc1cc2c(nn1)CCN(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C14H15N5O.C6H8/c15-16-13-8-11-9-19(7-6-12(11)17-18-13)14(20)10-4-2-1-3-5-10;1-2-5-4-6(5)3-1/h1-5,8H,6-7,9,15H2,(H,16,18);1-4H2 |
| InChIKey | OFXLPNKXOIFASG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|