About 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol
5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol (PubChem CID 70508743) has the molecular formula C20H18N2O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol.
Molecular Properties
| Compound Name | 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol |
| PubChem CID | 70508743 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol |
| SMILES | C=CCn1c2ccc(O)cc2c2c(C)c3cnccc3c(C)c21 |
| InChI | InChI=1S/C20H18N2O/c1-4-9-22-18-6-5-14(23)10-16(18)19-12(2)17-11-21-8-7-15(17)13(3)20(19)22/h4-8,10-11,23H,1,9H2,2-3H3 |
| InChIKey | RNXVNDQHYBQOIM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol?
The IUPAC name of 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol (CID 70508743) is 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol.
What is the SMILES notation for 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol?
The canonical SMILES for 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol is C=CCn1c2ccc(O)cc2c2c(C)c3cnccc3c(C)c21.
What is the InChIKey of 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol?
The InChIKey is RNXVNDQHYBQOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O/c1-4-9-22-18-6-5-14(23)10-16(18)19-12(2)17-11-21-8-7-15(17)13(3)20(19)22/h4-8,10-11,23H,1,9H2,2-3H3.
What are the key properties of 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol?
5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol has a molecular weight of 302.38 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-dimethyl-6-prop-2-enylpyrido[4,3-b]carbazol-9-ol is sourced from PubChem (CID 70508743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).