C10H13F3N4O3S — CID 70508751
(Z)-2-nitro-1-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine (PubChem CID 70508751) has the molecular formula C10H13F3N4O3S and a molecular weight of 326.30 g/mol. Its IUPAC name is (Z)-2-nitro-1-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine.
| Compound Name | (Z)-2-nitro-1-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 70508751 |
| Molecular Formula | C10H13F3N4O3S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (Z)-2-nitro-1-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
| SMILES | O=[N+]([O-])/C=C(\NCCSCc1ccon1)NCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3S/c11-10(12,13)7-15-9(5-17(18)19)14-2-4-21-6-8-1-3-20-16-8/h1,3,5,14-15H,2,4,6-7H2/b9-5+ |
| InChIKey | OCHMIICNFCASCR-WEVVVXLNSA-N |
| XLogP | 1.72 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|