About 4-chloroaniline;5-chloro-1H-indole;ethene
4-chloroaniline;5-chloro-1H-indole;ethene (PubChem CID 70508868) has the molecular formula C16H16Cl2N2
and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-chloroaniline;5-chloro-1H-indole;ethene.
Molecular Properties
| Compound Name | 4-chloroaniline;5-chloro-1H-indole;ethene |
| PubChem CID | 70508868 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-chloroaniline;5-chloro-1H-indole;ethene |
| SMILES | C=C.Clc1ccc2[nH]ccc2c1.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6ClN.C6H6ClN.C2H4/c9-7-1-2-8-6(5-7)3-4-10-8;7-5-1-3-6(8)4-2-5;1-2/h1-5,10H;1-4H,8H2;1-2H2 |
| InChIKey | RDQUQWZZOIRLTC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloroaniline;5-chloro-1H-indole;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroaniline;5-chloro-1H-indole;ethene?
The IUPAC name of 4-chloroaniline;5-chloro-1H-indole;ethene (CID 70508868) is 4-chloroaniline;5-chloro-1H-indole;ethene.
What is the SMILES notation for 4-chloroaniline;5-chloro-1H-indole;ethene?
The canonical SMILES for 4-chloroaniline;5-chloro-1H-indole;ethene is C=C.Clc1ccc2[nH]ccc2c1.Nc1ccc(Cl)cc1.
What is the InChIKey of 4-chloroaniline;5-chloro-1H-indole;ethene?
The InChIKey is RDQUQWZZOIRLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN.C6H6ClN.C2H4/c9-7-1-2-8-6(5-7)3-4-10-8;7-5-1-3-6(8)4-2-5;1-2/h1-5,10H;1-4H,8H2;1-2H2.
What are the key properties of 4-chloroaniline;5-chloro-1H-indole;ethene?
4-chloroaniline;5-chloro-1H-indole;ethene has a molecular weight of 307.22 g/mol, XLogP of 5.55, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroaniline;5-chloro-1H-indole;ethene is sourced from PubChem (CID 70508868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).