About 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione
2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 705090) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione.
Molecular Properties
| Compound Name | 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| PubChem CID | 705090 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | CC(C)(C)N1NC2(CCCCC2)NC1=S |
| InChI | InChI=1S/C11H21N3S/c1-10(2,3)14-9(15)12-11(13-14)7-5-4-6-8-11/h13H,4-8H2,1-3H3,(H,12,15) |
| InChIKey | IOSBDCUCLGSGRX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The IUPAC name of 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione (CID 705090) is 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione.
What is the SMILES notation for 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The canonical SMILES for 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione is CC(C)(C)N1NC2(CCCCC2)NC1=S.
What is the InChIKey of 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione?
The InChIKey is IOSBDCUCLGSGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-10(2,3)14-9(15)12-11(13-14)7-5-4-6-8-11/h13H,4-8H2,1-3H3,(H,12,15).
What are the key properties of 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione?
2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione has a molecular weight of 227.38 g/mol, XLogP of 2.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,2,4-triazaspiro[4.5]decane-3-thione is sourced from PubChem (CID 705090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).