C43H66N2O4 — CID 70509178
2-(3,4-dibenzyl-2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioic acid (PubChem CID 70509178) has the molecular formula C43H66N2O4 and a molecular weight of 675.01 g/mol. Its IUPAC name is 2-(3,4-dibenzyl-2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioic acid.
| Compound Name | 2-(3,4-dibenzyl-2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioic acid |
|---|---|
| PubChem CID | 70509178 |
| Molecular Formula | C43H66N2O4 |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 674.50 |
| IUPAC Name | 2-(3,4-dibenzyl-2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)propanedioic acid |
| SMILES | CCC1(C)CC(C(C(=O)O)(C(=O)O)C2(Cc3ccccc3)CC(C)(CC)N(C)C(C)(CC)C2(C)Cc2ccccc2)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C43H66N2O4/c1-13-37(6)29-34(31(5)39(8,15-3)44(37)11)43(35(46)47,36(48)49)42(28-33-25-21-18-22-26-33)30-38(7,14-2)45(12)41(10,16-4)40(42,9)27-32-23-19-17-20-24-32/h17-26,31,34H,13-16,27-30H2,1-12H3,(H,46,47)(H,48,49) |
| InChIKey | LWJQHPBLDSZTMV-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|