About benzene;3-tert-butylimidazolidine-2,4-dione
benzene;3-tert-butylimidazolidine-2,4-dione (PubChem CID 70509532) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is benzene;3-tert-butylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | benzene;3-tert-butylimidazolidine-2,4-dione |
| PubChem CID | 70509532 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | benzene;3-tert-butylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)N1C(=O)CNC1=O.c1ccccc1 |
| InChI | InChI=1S/C7H12N2O2.C6H6/c1-7(2,3)9-5(10)4-8-6(9)11;1-2-4-6-5-3-1/h4H2,1-3H3,(H,8,11);1-6H |
| InChIKey | KYEHSWNFOLQSIL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze benzene;3-tert-butylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-tert-butylimidazolidine-2,4-dione?
The IUPAC name of benzene;3-tert-butylimidazolidine-2,4-dione (CID 70509532) is benzene;3-tert-butylimidazolidine-2,4-dione.
What is the SMILES notation for benzene;3-tert-butylimidazolidine-2,4-dione?
The canonical SMILES for benzene;3-tert-butylimidazolidine-2,4-dione is CC(C)(C)N1C(=O)CNC1=O.c1ccccc1.
What is the InChIKey of benzene;3-tert-butylimidazolidine-2,4-dione?
The InChIKey is KYEHSWNFOLQSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2.C6H6/c1-7(2,3)9-5(10)4-8-6(9)11;1-2-4-6-5-3-1/h4H2,1-3H3,(H,8,11);1-6H.
What are the key properties of benzene;3-tert-butylimidazolidine-2,4-dione?
benzene;3-tert-butylimidazolidine-2,4-dione has a molecular weight of 234.30 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-tert-butylimidazolidine-2,4-dione is sourced from PubChem (CID 70509532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).