About (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one
(1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one (PubChem CID 70510041) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one.
Molecular Properties
| Compound Name | (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one |
| PubChem CID | 70510041 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one |
| SMILES | CC1=CC2[C@@H](C(=O)O1)C2(C)C |
| InChI | InChI=1S/C9H12O2/c1-5-4-6-7(8(10)11-5)9(6,2)3/h4,6-7H,1-3H3/t6?,7-/m0/s1 |
| InChIKey | WHUFACPDKQXVMW-MLWJPKLSSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one?
The IUPAC name of (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one (CID 70510041) is (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one.
What is the SMILES notation for (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one?
The canonical SMILES for (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one is CC1=CC2[C@@H](C(=O)O1)C2(C)C.
What is the InChIKey of (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one?
The InChIKey is WHUFACPDKQXVMW-MLWJPKLSSA-N. The full InChI is InChI=1S/C9H12O2/c1-5-4-6-7(8(10)11-5)9(6,2)3/h4,6-7H,1-3H3/t6?,7-/m0/s1.
What are the key properties of (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one?
(1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one has a molecular weight of 152.19 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4,7,7-trimethyl-3-oxabicyclo[4.1.0]hept-4-en-2-one is sourced from PubChem (CID 70510041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).