C19H25F3N8O7S — CID 70510091
but-2-enedioic acid;1-[2-[3-(3-methyl-2-methylsulfonyliminoimidazol-1-yl)propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70510091) has the molecular formula C19H25F3N8O7S and a molecular weight of 566.52 g/mol. Its IUPAC name is but-2-enedioic acid;1-[2-[3-(3-methyl-2-methylsulfonyliminoimidazol-1-yl)propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | but-2-enedioic acid;1-[2-[3-(3-methyl-2-methylsulfonyliminoimidazol-1-yl)propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70510091 |
| Molecular Formula | C19H25F3N8O7S |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | but-2-enedioic acid;1-[2-[3-(3-methyl-2-methylsulfonyliminoimidazol-1-yl)propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | Cn1ccn(CCCOc2nccc(N/C(N)=N/CC(F)(F)F)n2)c1=NS(C)(=O)=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H21F3N8O3S.C4H4O4/c1-25-7-8-26(14(25)24-30(2,27)28)6-3-9-29-13-20-5-4-11(23-13)22-12(19)21-10-15(16,17)18;5-3(6)1-2-4(7)8/h4-5,7-8H,3,6,9-10H2,1-2H3,(H3,19,20,21,22,23);1-2H,(H,5,6)(H,7,8) |
| InChIKey | WHTKINJQYNPLBO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|