About 2,6-bis(methylsulfanyl)oxane-3,5-dione
2,6-bis(methylsulfanyl)oxane-3,5-dione (PubChem CID 70510553) has the molecular formula C7H10O3S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2,6-bis(methylsulfanyl)oxane-3,5-dione.
Molecular Properties
| Compound Name | 2,6-bis(methylsulfanyl)oxane-3,5-dione |
| PubChem CID | 70510553 |
| Molecular Formula | C7H10O3S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 2,6-bis(methylsulfanyl)oxane-3,5-dione |
| SMILES | CSC1OC(SC)C(=O)CC1=O |
| InChI | InChI=1S/C7H10O3S2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h6-7H,3H2,1-2H3 |
| InChIKey | YJTABKBLAXZLAR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(methylsulfanyl)oxane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(methylsulfanyl)oxane-3,5-dione?
The IUPAC name of 2,6-bis(methylsulfanyl)oxane-3,5-dione (CID 70510553) is 2,6-bis(methylsulfanyl)oxane-3,5-dione.
What is the SMILES notation for 2,6-bis(methylsulfanyl)oxane-3,5-dione?
The canonical SMILES for 2,6-bis(methylsulfanyl)oxane-3,5-dione is CSC1OC(SC)C(=O)CC1=O.
What is the InChIKey of 2,6-bis(methylsulfanyl)oxane-3,5-dione?
The InChIKey is YJTABKBLAXZLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h6-7H,3H2,1-2H3.
What are the key properties of 2,6-bis(methylsulfanyl)oxane-3,5-dione?
2,6-bis(methylsulfanyl)oxane-3,5-dione has a molecular weight of 206.29 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(methylsulfanyl)oxane-3,5-dione is sourced from PubChem (CID 70510553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).