About 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene
5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene (PubChem CID 70511019) has the molecular formula C10H13Cl3O2
and a molecular weight of 271.57 g/mol. Its IUPAC name is 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene |
| PubChem CID | 70511019 |
| Molecular Formula | C10H13Cl3O2 |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene |
| SMILES | ClCCOC1C=CC=CC1(Cl)OCCCl |
| InChI | InChI=1S/C10H13Cl3O2/c11-5-7-14-9-3-1-2-4-10(9,13)15-8-6-12/h1-4,9H,5-8H2 |
| InChIKey | QONFIXVTFKLKID-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene?
The IUPAC name of 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene (CID 70511019) is 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene.
What is the SMILES notation for 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene?
The canonical SMILES for 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene is ClCCOC1C=CC=CC1(Cl)OCCCl.
What is the InChIKey of 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene?
The InChIKey is QONFIXVTFKLKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl3O2/c11-5-7-14-9-3-1-2-4-10(9,13)15-8-6-12/h1-4,9H,5-8H2.
What are the key properties of 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene?
5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene has a molecular weight of 271.57 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-5,6-bis(2-chloroethoxy)cyclohexa-1,3-diene is sourced from PubChem (CID 70511019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).