C10H17NO — CID 70511146
1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol (PubChem CID 70511146) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol.
| Compound Name | 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol |
|---|---|
| PubChem CID | 70511146 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-methyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol |
| SMILES | CN1CCCC2CC(O)CC=C21 |
| InChI | InChI=1S/C10H17NO/c1-11-6-2-3-8-7-9(12)4-5-10(8)11/h5,8-9,12H,2-4,6-7H2,1H3 |
| InChIKey | QYXLGXXZDSEBHG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |