C22H30O4S — CID 70511512
3-[[(7S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]propanoic acid (PubChem CID 70511512) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-[[(7S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[(7S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 70511512 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[(7S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]sulfanyl]propanoic acid |
| SMILES | C[C@]12CCC(=O)C=C1C[C@H](SCCC(=O)O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H30O4S/c1-21-8-5-14(23)11-13(21)12-17(27-10-7-19(25)26)20-15-3-4-18(24)22(15,2)9-6-16(20)21/h11,15-17,20H,3-10,12H2,1-2H3,(H,25,26)/t15-,16-,17-,20-,21-,22-/m0/s1 |
| InChIKey | OZLABWUNIWIISO-WSEGHWGGSA-N |
| XLogP | 4.27 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |