C25H24ClF3O2 — CID 70511606
trans-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1S,3S)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 70511606) has the molecular formula C25H24ClF3O2 and a molecular weight of 448.91 g/mol. Its IUPAC name is trans-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1S,3S)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1S,3S)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70511606 |
| Molecular Formula | C25H24ClF3O2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | trans-6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1S,3S)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C=C(F)C(F)(F)Cl)[C@@H]1C(=O)OCc1cccc2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C25H24ClF3O2/c1-24(2)20(13-21(27)25(26,28)29)22(24)23(30)31-14-16-9-6-12-19-17-10-4-3-7-15(17)8-5-11-18(16)19/h3-4,6-7,9-10,12-13,20,22H,5,8,11,14H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | MCOJHTBACNOKHJ-IFMALSPDSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|