C14H20BrNO5S — CID 70511659
2,2-dimethylpropanoyloxymethyl (2S)-5-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70511659) has the molecular formula C14H20BrNO5S and a molecular weight of 394.29 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S)-5-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S)-5-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70511659 |
| Molecular Formula | C14H20BrNO5S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S)-5-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)CC2(Br)SC1(C)C |
| InChI | InChI=1S/C14H20BrNO5S/c1-12(2,3)11(19)21-7-20-10(18)9-13(4,5)22-14(15)6-8(17)16(9)14/h9H,6-7H2,1-5H3/t9-,14?/m0/s1 |
| InChIKey | ZWPJBDNLOHHEMA-CUVJYRNJSA-N |
| XLogP | 2.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|