About 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine
4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine (PubChem CID 70511719) has the molecular formula C10H10F3N3
and a molecular weight of 229.21 g/mol. Its IUPAC name is 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine |
| PubChem CID | 70511719 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(C(F)(F)F)CC1c1ccccc1 |
| InChI | InChI=1S/C10H10F3N3/c11-10(12,13)16-6-8(9(14)15-16)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,14,15) |
| InChIKey | PZAKQDAHJUBWPV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine?
The IUPAC name of 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine (CID 70511719) is 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine.
What is the SMILES notation for 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine?
The canonical SMILES for 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine is NC1=NN(C(F)(F)F)CC1c1ccccc1.
What is the InChIKey of 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine?
The InChIKey is PZAKQDAHJUBWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3/c11-10(12,13)16-6-8(9(14)15-16)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,14,15).
What are the key properties of 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine?
4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine has a molecular weight of 229.21 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2-(trifluoromethyl)-3,4-dihydropyrazol-5-amine is sourced from PubChem (CID 70511719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).