C55H105N7O — CID 70511721
3,3,5,5,7-pentakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,4-diazepan-2-one (PubChem CID 70511721) has the molecular formula C55H105N7O and a molecular weight of 880.49 g/mol. Its IUPAC name is 3,3,5,5,7-pentakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,4-diazepan-2-one.
| Compound Name | 3,3,5,5,7-pentakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 70511721 |
| Molecular Formula | C55H105N7O |
| Molecular Weight | 880.49 g/mol |
| Exact Mass | 879.84 |
| IUPAC Name | 3,3,5,5,7-pentakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,4-diazepan-2-one |
| SMILES | CN1C(C)(C)CC(C2CC(C3CC(C)(C)N(C)C(C)(C)C3)(C3CC(C)(C)N(C)C(C)(C)C3)NC(C3CC(C)(C)N(C)C(C)(C)C3)(C3CC(C)(C)N(C)C(C)(C)C3)C(=O)N2)CC1(C)C |
| InChI | InChI=1S/C55H105N7O/c1-44(2)26-37(27-45(3,4)58(44)21)42-36-54(38-28-46(5,6)59(22)47(7,8)29-38,39-30-48(9,10)60(23)49(11,12)31-39)57-55(43(63)56-42,40-32-50(13,14)61(24)51(15,16)33-40)41-34-52(17,18)62(25)53(19,20)35-41/h37-42,57H,26-36H2,1-25H3,(H,56,63) |
| InChIKey | WHXBDFFPPWKFFV-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.49 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |