C24H24Br2Cl2O2 — CID 70511753
6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1R)-3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 70511753) has the molecular formula C24H24Br2Cl2O2 and a molecular weight of 575.17 g/mol. Its IUPAC name is 6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1R)-3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1R)-3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70511753 |
| Molecular Formula | C24H24Br2Cl2O2 |
| Molecular Weight | 575.17 g/mol |
| Exact Mass | 571.95 |
| IUPAC Name | 6-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylmethyl (1R)-3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(Br)C(Cl)(Cl)Br)[C@H]1C(=O)OCc1cccc2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C24H24Br2Cl2O2/c1-23(2)19(21(25)24(26,27)28)20(23)22(29)30-13-15-9-6-12-18-16-10-4-3-7-14(16)8-5-11-17(15)18/h3-4,6-7,9-10,12,19-21H,5,8,11,13H2,1-2H3/t19?,20-,21?/m0/s1 |
| InChIKey | CRBVXVPZJNYZOF-KBWCOIMZSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.17 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|