About 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene
5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene (PubChem CID 70511960) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene.
Molecular Properties
| Compound Name | 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene |
| PubChem CID | 70511960 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene |
| SMILES | C=C.CC(=O)C1CC2CC1CC2=O.CCOC(C)OCC |
| InChI | InChI=1S/C9H12O2.C6H14O2.C2H4/c1-5(10)8-3-7-2-6(8)4-9(7)11;1-4-7-6(3)8-5-2;1-2/h6-8H,2-4H2,1H3;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | KUBINIQYNDTGBW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene?
The IUPAC name of 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene (CID 70511960) is 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene.
What is the SMILES notation for 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene?
The canonical SMILES for 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene is C=C.CC(=O)C1CC2CC1CC2=O.CCOC(C)OCC.
What is the InChIKey of 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene?
The InChIKey is KUBINIQYNDTGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C6H14O2.C2H4/c1-5(10)8-3-7-2-6(8)4-9(7)11;1-4-7-6(3)8-5-2;1-2/h6-8H,2-4H2,1H3;6H,4-5H2,1-3H3;1-2H2.
What are the key properties of 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene?
5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene has a molecular weight of 298.42 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetylbicyclo[2.2.1]heptan-2-one;1,1-diethoxyethane;ethene is sourced from PubChem (CID 70511960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).