C29H34Cl2N8O2 — CID 70512134
2,3-dichloro-N-(2,6-diethylphenyl)-N'-(2-ethyl-6-methylphenyl)-N,N'-bis(1,2,4-triazol-1-ylmethyl)butanediamide (PubChem CID 70512134) has the molecular formula C29H34Cl2N8O2 and a molecular weight of 597.55 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,6-diethylphenyl)-N'-(2-ethyl-6-methylphenyl)-N,N'-bis(1,2,4-triazol-1-ylmethyl)butanediamide.
| Compound Name | 2,3-dichloro-N-(2,6-diethylphenyl)-N'-(2-ethyl-6-methylphenyl)-N,N'-bis(1,2,4-triazol-1-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 70512134 |
| Molecular Formula | C29H34Cl2N8O2 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2,3-dichloro-N-(2,6-diethylphenyl)-N'-(2-ethyl-6-methylphenyl)-N,N'-bis(1,2,4-triazol-1-ylmethyl)butanediamide |
| SMILES | CCc1cccc(C)c1N(Cn1cncn1)C(=O)C(Cl)C(Cl)C(=O)N(Cn1cncn1)c1c(CC)cccc1CC |
| InChI | InChI=1S/C29H34Cl2N8O2/c1-5-21-11-8-10-20(4)26(21)38(18-36-16-32-14-34-36)28(40)24(30)25(31)29(41)39(19-37-17-33-15-35-37)27-22(6-2)12-9-13-23(27)7-3/h8-17,24-25H,5-7,18-19H2,1-4H3 |
| InChIKey | FORSSPFJMXUHAJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|